C29H26F4O2 — CID 143908701
4-[4-[4-[(4Z)-4,5-difluoro-6-methoxy-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluorophenyl]phenol;ethene (PubChem CID 143908701) has the molecular formula C29H26F4O2 and a molecular weight of 482.52 g/mol. Its IUPAC name is 4-[4-[4-[(4Z)-4,5-difluoro-6-methoxy-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluorophenyl]phenol;ethene.
| Compound Name | 4-[4-[4-[(4Z)-4,5-difluoro-6-methoxy-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluorophenyl]phenol;ethene |
|---|---|
| PubChem CID | 143908701 |
| Molecular Formula | C29H26F4O2 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 4-[4-[4-[(4Z)-4,5-difluoro-6-methoxy-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluorophenyl]phenol;ethene |
| SMILES | C=C.C=C(CCc1ccc(-c2ccc(-c3ccc(O)cc3)c(F)c2F)cc1)/C(F)=C(/F)C(=C)OC |
| InChI | InChI=1S/C27H22F4O2.C2H4/c1-16(24(28)25(29)17(2)33-3)4-5-18-6-8-19(9-7-18)22-14-15-23(27(31)26(22)30)20-10-12-21(32)13-11-20;1-2/h6-15,32H,1-2,4-5H2,3H3;1-2H2/b25-24-; |
| InChIKey | SQWTZEOZBQZLBQ-BJFQDICYSA-N |
| XLogP | 8.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|