C27H22F4O2 — CID 143909386
1-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluoro-4-(4-methylphenyl)benzene (PubChem CID 143909386) has the molecular formula C27H22F4O2 and a molecular weight of 454.46 g/mol. Its IUPAC name is 1-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluoro-4-(4-methylphenyl)benzene.
| Compound Name | 1-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluoro-4-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 143909386 |
| Molecular Formula | C27H22F4O2 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluoro-4-(4-methylphenyl)benzene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)OCc1ccc(-c2ccc(-c3ccc(C)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C27H22F4O2/c1-16-5-9-20(10-6-16)22-13-14-23(27(31)26(22)30)21-11-7-19(8-12-21)15-33-18(3)25(29)24(28)17(2)32-4/h5-14H,2-3,15H2,1,4H3/b25-24- |
| InChIKey | GDRDFIKBIMQQHW-IZHYLOQSSA-N |
| XLogP | 7.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|