C27H22F4O — CID 143909270
1-[4-[[(3Z)-3,4-difluoro-5-methylhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluoro-4-(4-methylphenyl)benzene (PubChem CID 143909270) has the molecular formula C27H22F4O and a molecular weight of 438.46 g/mol. Its IUPAC name is 1-[4-[[(3Z)-3,4-difluoro-5-methylhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluoro-4-(4-methylphenyl)benzene.
| Compound Name | 1-[4-[[(3Z)-3,4-difluoro-5-methylhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluoro-4-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 143909270 |
| Molecular Formula | C27H22F4O |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-[4-[[(3Z)-3,4-difluoro-5-methylhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluoro-4-(4-methylphenyl)benzene |
| SMILES | C=C(C)/C(F)=C(/F)C(=C)OCc1ccc(-c2ccc(-c3ccc(C)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C27H22F4O/c1-16(2)24(28)25(29)18(4)32-15-19-7-11-21(12-8-19)23-14-13-22(26(30)27(23)31)20-9-5-17(3)6-10-20/h5-14H,1,4,15H2,2-3H3/b25-24- |
| InChIKey | NIAKDJHOBMFQOW-IZHYLOQSSA-N |
| XLogP | 8.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|