C9H17NO2 — CID 154006676
(3E)-5-methoxy-N-(methoxymethyl)hexa-3,5-dien-3-amine (PubChem CID 154006676) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (3E)-5-methoxy-N-(methoxymethyl)hexa-3,5-dien-3-amine.
| Compound Name | (3E)-5-methoxy-N-(methoxymethyl)hexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 154006676 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (3E)-5-methoxy-N-(methoxymethyl)hexa-3,5-dien-3-amine |
| SMILES | C=C(/C=C(\CC)NCOC)OC |
| InChI | InChI=1S/C9H17NO2/c1-5-9(10-7-11-3)6-8(2)12-4/h6,10H,2,5,7H2,1,3-4H3/b9-6+ |
| InChIKey | NFTRAEOSMNQTNF-RMKNXTFCSA-N |
| XLogP | 1.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|