About O-methyl N-iminocarbamothioate
O-methyl N-iminocarbamothioate (PubChem CID 141030958) has the molecular formula C2H4N2OS
and a molecular weight of 104.13 g/mol. Its IUPAC name is O-methyl N-iminocarbamothioate.
Molecular Properties
| Compound Name | O-methyl N-iminocarbamothioate |
| PubChem CID | 141030958 |
| Molecular Formula | C2H4N2OS |
| Molecular Weight | 104.13 g/mol |
| Exact Mass | 104.00 |
| IUPAC Name | O-methyl N-iminocarbamothioate |
| SMILES | [H]/N=N/C(=S)OC |
| InChI | InChI=1S/C2H4N2OS/c1-5-2(6)4-3/h3H,1H3/b4-3+ |
| InChIKey | FWYJPSPFAIPOFY-ONEGZZNKSA-N |
| XLogP | 0.95 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.13 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl N-iminocarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl N-iminocarbamothioate?
The IUPAC name of O-methyl N-iminocarbamothioate (CID 141030958) is O-methyl N-iminocarbamothioate.
What is the SMILES notation for O-methyl N-iminocarbamothioate?
The canonical SMILES for O-methyl N-iminocarbamothioate is [H]/N=N/C(=S)OC.
What is the InChIKey of O-methyl N-iminocarbamothioate?
The InChIKey is FWYJPSPFAIPOFY-ONEGZZNKSA-N. The full InChI is InChI=1S/C2H4N2OS/c1-5-2(6)4-3/h3H,1H3/b4-3+.
What are the key properties of O-methyl N-iminocarbamothioate?
O-methyl N-iminocarbamothioate has a molecular weight of 104.13 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl N-iminocarbamothioate is sourced from PubChem (CID 141030958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).