C3H8N8 — CID 152539048
1-N',3-N'-diamino-1-N,3-N-diiminopropanediimidamide (PubChem CID 152539048) has the molecular formula C3H8N8 and a molecular weight of 156.15 g/mol. Its IUPAC name is 1-N',3-N'-diamino-1-N,3-N-diiminopropanediimidamide.
| Compound Name | 1-N',3-N'-diamino-1-N,3-N-diiminopropanediimidamide |
|---|---|
| PubChem CID | 152539048 |
| Molecular Formula | C3H8N8 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-N',3-N'-diamino-1-N,3-N-diiminopropanediimidamide |
| SMILES | [H]/N=N/C(CC(=NN)/N=N/[H])=NN |
| InChI | InChI=1S/C3H8N8/c4-8-2(9-5)1-3(10-6)11-7/h4,6H,1,5,7H2/b8-4+,9-2?,10-6+,11-3? |
| InChIKey | YLDOHSNLEIWHFJ-GDJRANTQSA-N |
| XLogP | -0.02 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|