C16H15N5O3S — CID 172934400
3-[[4-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]sulfanylbenzoyl]amino]benzoic acid (PubChem CID 172934400) has the molecular formula C16H15N5O3S and a molecular weight of 357.40 g/mol. Its IUPAC name is 3-[[4-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]sulfanylbenzoyl]amino]benzoic acid.
| Compound Name | 3-[[4-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]sulfanylbenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 172934400 |
| Molecular Formula | C16H15N5O3S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-[[4-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]sulfanylbenzoyl]amino]benzoic acid |
| SMILES | [H]/N=N/C(CSc1ccc(C(=O)Nc2cccc(C(=O)O)c2)cc1)=N\N |
| InChI | InChI=1S/C16H15N5O3S/c17-20-14(21-18)9-25-13-6-4-10(5-7-13)15(22)19-12-3-1-2-11(8-12)16(23)24/h1-8,17H,9,18H2,(H,19,22)(H,23,24)/b20-17+,21-14- |
| InChIKey | ZWWLNNAOEOLPNU-ODODVPFTSA-N |
| XLogP | 3.03 |
| TPSA | 140.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|