C15H15N5OS — CID 173497573
4-[2-amino-2-(iminohydrazinylidene)ethyl]sulfanyl-N-phenylbenzamide (PubChem CID 173497573) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is 4-[2-amino-2-(iminohydrazinylidene)ethyl]sulfanyl-N-phenylbenzamide.
| Compound Name | 4-[2-amino-2-(iminohydrazinylidene)ethyl]sulfanyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 173497573 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-[2-amino-2-(iminohydrazinylidene)ethyl]sulfanyl-N-phenylbenzamide |
| SMILES | [H]/N=N/N=C(N)CSc1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H15N5OS/c16-14(19-20-17)10-22-13-8-6-11(7-9-13)15(21)18-12-4-2-1-3-5-12/h1-9H,10H2,(H,18,21)(H3,16,17,19) |
| InChIKey | PLPUQJWYPWTHSI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|