C17H15N5O3 — CID 173497578
(E)-3-[4-[[4-(N'-diazenylcarbamimidoyl)benzoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 173497578) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is (E)-3-[4-[[4-(N'-diazenylcarbamimidoyl)benzoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-(N'-diazenylcarbamimidoyl)benzoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 173497578 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (E)-3-[4-[[4-(N'-diazenylcarbamimidoyl)benzoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | [H]/N=N/N=C(N)c1ccc(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H15N5O3/c18-16(21-22-19)12-4-6-13(7-5-12)17(25)20-14-8-1-11(2-9-14)3-10-15(23)24/h1-10H,(H,20,25)(H,23,24)(H3,18,19,21)/b10-3+ |
| InChIKey | GHNXNEGEDTZUKG-XCVCLJGOSA-N |
| XLogP | 2.69 |
| TPSA | 140.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|