C13H28N8S2 — CID 174375098
[2-(formazan-3-ylsulfanylmethyl)-4-methyl-2-(2-methylpropyl)pentyl] N'-amino-N-iminocarbamimidothioate (PubChem CID 174375098) has the molecular formula C13H28N8S2 and a molecular weight of 360.56 g/mol. Its IUPAC name is [2-(formazan-3-ylsulfanylmethyl)-4-methyl-2-(2-methylpropyl)pentyl] N'-amino-N-iminocarbamimidothioate.
| Compound Name | [2-(formazan-3-ylsulfanylmethyl)-4-methyl-2-(2-methylpropyl)pentyl] N'-amino-N-iminocarbamimidothioate |
|---|---|
| PubChem CID | 174375098 |
| Molecular Formula | C13H28N8S2 |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [2-(formazan-3-ylsulfanylmethyl)-4-methyl-2-(2-methylpropyl)pentyl] N'-amino-N-iminocarbamimidothioate |
| SMILES | [H]/N=N/C(=NN)SCC(CSC(=NN)/N=N/[H])(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H28N8S2/c1-9(2)5-13(6-10(3)4,7-22-11(18-14)19-15)8-23-12(20-16)21-17/h9-10,14,16H,5-8,15,17H2,1-4H3/b18-14+,19-11?,20-16+,21-12? |
| InChIKey | ASOUORSGVGNQHY-OQVRPXRYSA-N |
| XLogP | 4.05 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|