C12H26N4O — CID 142311021
N'-amino-N-imino-2,2,6-trimethyl-5-oxoheptanimidamide;ethane (PubChem CID 142311021) has the molecular formula C12H26N4O and a molecular weight of 242.37 g/mol. Its IUPAC name is N'-amino-N-imino-2,2,6-trimethyl-5-oxoheptanimidamide;ethane.
| Compound Name | N'-amino-N-imino-2,2,6-trimethyl-5-oxoheptanimidamide;ethane |
|---|---|
| PubChem CID | 142311021 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | N'-amino-N-imino-2,2,6-trimethyl-5-oxoheptanimidamide;ethane |
| SMILES | CC.[H]/N=N/C(=N\N)C(C)(C)CCC(=O)C(C)C |
| InChI | InChI=1S/C10H20N4O.C2H6/c1-7(2)8(15)5-6-10(3,4)9(13-11)14-12;1-2/h7,11H,5-6,12H2,1-4H3;1-2H3/b13-11+,14-9-; |
| InChIKey | QWMSZMIKPZNZTL-TXXMJRAPSA-N |
| XLogP | 3.35 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|