C6H7N9O2S2 — CID 174433726
2-cyano-3,3-bis(formazan-3-ylsulfanyl)prop-2-enoic acid (PubChem CID 174433726) has the molecular formula C6H7N9O2S2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-cyano-3,3-bis(formazan-3-ylsulfanyl)prop-2-enoic acid.
| Compound Name | 2-cyano-3,3-bis(formazan-3-ylsulfanyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 174433726 |
| Molecular Formula | C6H7N9O2S2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-cyano-3,3-bis(formazan-3-ylsulfanyl)prop-2-enoic acid |
| SMILES | [H]/N=N/C(=NN)SC(SC(=NN)/N=N/[H])=C(C#N)C(=O)O |
| InChI | InChI=1S/C6H7N9O2S2/c7-1-2(3(16)17)4(18-5(12-8)13-9)19-6(14-10)15-11/h8,10H,9,11H2,(H,16,17)/b4-2?,12-8+,13-5?,14-10+,15-6? |
| InChIKey | FLTJAPLWSJWVEP-QCBRNAIRSA-N |
| XLogP | 0.79 |
| TPSA | 210.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|