C5H12N8S2 — CID 174430826
3-formazan-3-ylsulfanylpropyl N'-amino-N-iminocarbamimidothioate (PubChem CID 174430826) has the molecular formula C5H12N8S2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 3-formazan-3-ylsulfanylpropyl N'-amino-N-iminocarbamimidothioate.
| Compound Name | 3-formazan-3-ylsulfanylpropyl N'-amino-N-iminocarbamimidothioate |
|---|---|
| PubChem CID | 174430826 |
| Molecular Formula | C5H12N8S2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-formazan-3-ylsulfanylpropyl N'-amino-N-iminocarbamimidothioate |
| SMILES | [H]/N=N/C(=NN)SCCCSC(=NN)/N=N/[H] |
| InChI | InChI=1S/C5H12N8S2/c6-10-4(11-7)14-2-1-3-15-5(12-8)13-9/h6,8H,1-3,7,9H2/b10-6+,11-4?,12-8+,13-5? |
| InChIKey | DZDYJNDHCWGGGD-XBGTYGKLSA-N |
| XLogP | 1.36 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|