About 6-hydroxyhexyl N'-aminocarbamimidothioate
6-hydroxyhexyl N'-aminocarbamimidothioate (PubChem CID 107707344) has the molecular formula C7H17N3OS
and a molecular weight of 191.30 g/mol. Its IUPAC name is 6-hydroxyhexyl N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl N'-aminocarbamimidothioate |
| PubChem CID | 107707344 |
| Molecular Formula | C7H17N3OS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 6-hydroxyhexyl N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCCCCCCO |
| InChI | InChI=1S/C7H17N3OS/c8-7(10-9)12-6-4-2-1-3-5-11/h11H,1-6,9H2,(H2,8,10) |
| InChIKey | CKMIONJNIKTTIR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl N'-aminocarbamimidothioate?
The IUPAC name of 6-hydroxyhexyl N'-aminocarbamimidothioate (CID 107707344) is 6-hydroxyhexyl N'-aminocarbamimidothioate.
What is the SMILES notation for 6-hydroxyhexyl N'-aminocarbamimidothioate?
The canonical SMILES for 6-hydroxyhexyl N'-aminocarbamimidothioate is NN=C(N)SCCCCCCO.
What is the InChIKey of 6-hydroxyhexyl N'-aminocarbamimidothioate?
The InChIKey is CKMIONJNIKTTIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3OS/c8-7(10-9)12-6-4-2-1-3-5-11/h11H,1-6,9H2,(H2,8,10).
What are the key properties of 6-hydroxyhexyl N'-aminocarbamimidothioate?
6-hydroxyhexyl N'-aminocarbamimidothioate has a molecular weight of 191.30 g/mol, XLogP of 0.46, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl N'-aminocarbamimidothioate is sourced from PubChem (CID 107707344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).