About 6-hydroxyhexyl carbamimidothioate
6-hydroxyhexyl carbamimidothioate (PubChem CID 15370310) has the molecular formula C7H16N2OS
and a molecular weight of 176.28 g/mol. Its IUPAC name is 6-hydroxyhexyl carbamimidothioate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl carbamimidothioate |
| PubChem CID | 15370310 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 6-hydroxyhexyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCCCCO |
| InChI | InChI=1S/C7H16N2OS/c8-7(9)11-6-4-2-1-3-5-10/h10H,1-6H2,(H3,8,9) |
| InChIKey | DSYVKOVUVDHLBM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl carbamimidothioate?
The IUPAC name of 6-hydroxyhexyl carbamimidothioate (CID 15370310) is 6-hydroxyhexyl carbamimidothioate.
What is the SMILES notation for 6-hydroxyhexyl carbamimidothioate?
The canonical SMILES for 6-hydroxyhexyl carbamimidothioate is [H]/N=C(\N)SCCCCCCO.
What is the InChIKey of 6-hydroxyhexyl carbamimidothioate?
The InChIKey is DSYVKOVUVDHLBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2OS/c8-7(9)11-6-4-2-1-3-5-10/h10H,1-6H2,(H3,8,9).
What are the key properties of 6-hydroxyhexyl carbamimidothioate?
6-hydroxyhexyl carbamimidothioate has a molecular weight of 176.28 g/mol, XLogP of 1.17, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl carbamimidothioate is sourced from PubChem (CID 15370310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).