About [(Z)-octadec-9-enyl] carbamimidothioate
[(Z)-octadec-9-enyl] carbamimidothioate (PubChem CID 132599711) has the molecular formula C19H38N2S
and a molecular weight of 326.59 g/mol. Its IUPAC name is [(Z)-octadec-9-enyl] carbamimidothioate.
Molecular Properties
| Compound Name | [(Z)-octadec-9-enyl] carbamimidothioate |
| PubChem CID | 132599711 |
| Molecular Formula | C19H38N2S |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | [(Z)-octadec-9-enyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C19H38N2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21/h9-10H,2-8,11-18H2,1H3,(H3,20,21)/b10-9- |
| InChIKey | CULJNQVABGGVIF-KTKRTIGZSA-N |
| XLogP | 6.65 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-octadec-9-enyl] carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-octadec-9-enyl] carbamimidothioate?
The IUPAC name of [(Z)-octadec-9-enyl] carbamimidothioate (CID 132599711) is [(Z)-octadec-9-enyl] carbamimidothioate.
What is the SMILES notation for [(Z)-octadec-9-enyl] carbamimidothioate?
The canonical SMILES for [(Z)-octadec-9-enyl] carbamimidothioate is [H]/N=C(\N)SCCCCCCCC/C=C\CCCCCCCC.
What is the InChIKey of [(Z)-octadec-9-enyl] carbamimidothioate?
The InChIKey is CULJNQVABGGVIF-KTKRTIGZSA-N. The full InChI is InChI=1S/C19H38N2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21/h9-10H,2-8,11-18H2,1H3,(H3,20,21)/b10-9-.
What are the key properties of [(Z)-octadec-9-enyl] carbamimidothioate?
[(Z)-octadec-9-enyl] carbamimidothioate has a molecular weight of 326.59 g/mol, XLogP of 6.65, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-octadec-9-enyl] carbamimidothioate is sourced from PubChem (CID 132599711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).