About N'-amino-N-iminobenzenecarboximidamide;methane
N'-amino-N-iminobenzenecarboximidamide;methane (PubChem CID 143158063) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is N'-amino-N-iminobenzenecarboximidamide;methane.
Molecular Properties
| Compound Name | N'-amino-N-iminobenzenecarboximidamide;methane |
| PubChem CID | 143158063 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | N'-amino-N-iminobenzenecarboximidamide;methane |
| SMILES | C.[H]/N=N/C(=N\N)c1ccccc1 |
| InChI | InChI=1S/C7H8N4.CH4/c8-10-7(11-9)6-4-2-1-3-5-6;/h1-5,8H,9H2;1H4/b10-8+,11-7-; |
| InChIKey | LKCFOEPNXHMDDB-GOZDGITISA-N |
| XLogP | 1.97 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-N-iminobenzenecarboximidamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-N-iminobenzenecarboximidamide;methane?
The IUPAC name of N'-amino-N-iminobenzenecarboximidamide;methane (CID 143158063) is N'-amino-N-iminobenzenecarboximidamide;methane.
What is the SMILES notation for N'-amino-N-iminobenzenecarboximidamide;methane?
The canonical SMILES for N'-amino-N-iminobenzenecarboximidamide;methane is C.[H]/N=N/C(=N\N)c1ccccc1.
What is the InChIKey of N'-amino-N-iminobenzenecarboximidamide;methane?
The InChIKey is LKCFOEPNXHMDDB-GOZDGITISA-N. The full InChI is InChI=1S/C7H8N4.CH4/c8-10-7(11-9)6-4-2-1-3-5-6;/h1-5,8H,9H2;1H4/b10-8+,11-7-;.
What are the key properties of N'-amino-N-iminobenzenecarboximidamide;methane?
N'-amino-N-iminobenzenecarboximidamide;methane has a molecular weight of 164.21 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-N-iminobenzenecarboximidamide;methane is sourced from PubChem (CID 143158063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).