About ethane;1-phenylethanimine
ethane;1-phenylethanimine (PubChem CID 91121262) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is ethane;1-phenylethanimine.
Molecular Properties
| Compound Name | ethane;1-phenylethanimine |
| PubChem CID | 91121262 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | ethane;1-phenylethanimine |
| SMILES | CC.[H]/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C8H9N.C2H6/c1-7(9)8-5-3-2-4-6-8;1-2/h2-6,9H,1H3;1-2H3/b9-7+; |
| InChIKey | JIKQVWIARDUUMT-BXTVWIJMSA-N |
| XLogP | 3.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-phenylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-phenylethanimine?
The IUPAC name of ethane;1-phenylethanimine (CID 91121262) is ethane;1-phenylethanimine.
What is the SMILES notation for ethane;1-phenylethanimine?
The canonical SMILES for ethane;1-phenylethanimine is CC.[H]/N=C(\C)c1ccccc1.
What is the InChIKey of ethane;1-phenylethanimine?
The InChIKey is JIKQVWIARDUUMT-BXTVWIJMSA-N. The full InChI is InChI=1S/C8H9N.C2H6/c1-7(9)8-5-3-2-4-6-8;1-2/h2-6,9H,1H3;1-2H3/b9-7+;.
What are the key properties of ethane;1-phenylethanimine?
ethane;1-phenylethanimine has a molecular weight of 149.24 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-phenylethanimine is sourced from PubChem (CID 91121262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).