About diphenylmethanimine;ethane
diphenylmethanimine;ethane (PubChem CID 145102767) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is diphenylmethanimine;ethane.
Molecular Properties
| Compound Name | diphenylmethanimine;ethane |
| PubChem CID | 145102767 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | diphenylmethanimine;ethane |
| SMILES | CC.[H]N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11N.C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10,14H;1-2H3 |
| InChIKey | UBCMEAOCDZNVEY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanimine;ethane?
The IUPAC name of diphenylmethanimine;ethane (CID 145102767) is diphenylmethanimine;ethane.
What is the SMILES notation for diphenylmethanimine;ethane?
The canonical SMILES for diphenylmethanimine;ethane is CC.[H]N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanimine;ethane?
The InChIKey is UBCMEAOCDZNVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N.C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10,14H;1-2H3.
What are the key properties of diphenylmethanimine;ethane?
diphenylmethanimine;ethane has a molecular weight of 211.31 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanimine;ethane is sourced from PubChem (CID 145102767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).