C7H7N7S — CID 172960814
N'-amino-N-imino-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide (PubChem CID 172960814) has the molecular formula C7H7N7S and a molecular weight of 221.25 g/mol. Its IUPAC name is N'-amino-N-imino-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide.
| Compound Name | N'-amino-N-imino-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide |
|---|---|
| PubChem CID | 172960814 |
| Molecular Formula | C7H7N7S |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | N'-amino-N-imino-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide |
| SMILES | [H]/N=N/C(=N\N)c1ccc2n[nH]c(=S)n2c1 |
| InChI | InChI=1S/C7H7N7S/c8-10-6(11-9)4-1-2-5-12-13-7(15)14(5)3-4/h1-3,8H,9H2,(H,13,15)/b10-8+,11-6- |
| InChIKey | YKFDMYDUKCHNKQ-OSHZIQPQSA-N |
| XLogP | 1.04 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|