C17H17N5O4 — CID 142223660
4-[[3-[4-[(Z)-N-iminocarbamohydrazonoyl]phenyl]oxiran-2-yl]amino]-3-methoxybenzoic acid (PubChem CID 142223660) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[[3-[4-[(Z)-N-iminocarbamohydrazonoyl]phenyl]oxiran-2-yl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[[3-[4-[(Z)-N-iminocarbamohydrazonoyl]phenyl]oxiran-2-yl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 142223660 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-[[3-[4-[(Z)-N-iminocarbamohydrazonoyl]phenyl]oxiran-2-yl]amino]-3-methoxybenzoic acid |
| SMILES | [H]/N=N/C(=N\N)c1ccc(C2OC2Nc2ccc(C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C17H17N5O4/c1-25-13-8-11(17(23)24)6-7-12(13)20-16-14(26-16)9-2-4-10(5-3-9)15(21-18)22-19/h2-8,14,16,18,20H,19H2,1H3,(H,23,24)/b21-18+,22-15- |
| InChIKey | PJXUONODPMDLRT-XQJKZNAJSA-N |
| XLogP | 2.55 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|