C8H7ClFeN2O2 — CID 175040319
benzene-1,4-dicarboximidate;iron(2+);hydrochloride (PubChem CID 175040319) has the molecular formula C8H7ClFeN2O2 and a molecular weight of 254.45 g/mol. Its IUPAC name is benzene-1,4-dicarboximidate;iron(2+);hydrochloride.
| Compound Name | benzene-1,4-dicarboximidate;iron(2+);hydrochloride |
|---|---|
| PubChem CID | 175040319 |
| Molecular Formula | C8H7ClFeN2O2 |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | benzene-1,4-dicarboximidate;iron(2+);hydrochloride |
| SMILES | Cl.[Fe+2].[H]/N=C(\[O-])c1ccc(/C([O-])=N/[H])cc1 |
| InChI | InChI=1S/C8H8N2O2.ClH.Fe/c9-7(11)5-1-2-6(4-3-5)8(10)12;;/h1-4H,(H2,9,11)(H2,10,12);1H;/q;;+2/p-2 |
| InChIKey | VPLQOYYDCARVOW-UHFFFAOYSA-L |
| XLogP | -0.52 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|