C7H7N5 — CID 83873033
[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide (PubChem CID 83873033) has the molecular formula C7H7N5 and a molecular weight of 161.17 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide.
| Compound Name | [1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide |
|---|---|
| PubChem CID | 83873033 |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | [1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nncn2c1 |
| InChI | InChI=1S/C7H7N5/c8-7(9)5-1-2-6-11-10-4-12(6)3-5/h1-4H,(H3,8,9) |
| InChIKey | MNNCMJBYAVGTMF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|