C8H7N5O2 — CID 83882201
1-nitroimidazo[1,5-a]pyridine-6-carboximidamide (PubChem CID 83882201) has the molecular formula C8H7N5O2 and a molecular weight of 205.18 g/mol. Its IUPAC name is 1-nitroimidazo[1,5-a]pyridine-6-carboximidamide.
| Compound Name | 1-nitroimidazo[1,5-a]pyridine-6-carboximidamide |
|---|---|
| PubChem CID | 83882201 |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 1-nitroimidazo[1,5-a]pyridine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c([N+](=O)[O-])ncn2c1 |
| InChI | InChI=1S/C8H7N5O2/c9-7(10)5-1-2-6-8(13(14)15)11-4-12(6)3-5/h1-4H,(H3,9,10) |
| InChIKey | SZPWJQKXMXDYHG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|