C9H10N4 — CID 83874294
6-methylimidazo[1,5-a]pyridine-1-carboximidamide (PubChem CID 83874294) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 6-methylimidazo[1,5-a]pyridine-1-carboximidamide.
| Compound Name | 6-methylimidazo[1,5-a]pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 83874294 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 6-methylimidazo[1,5-a]pyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncn2cc(C)ccc12 |
| InChI | InChI=1S/C9H10N4/c1-6-2-3-7-8(9(10)11)12-5-13(7)4-6/h2-5H,1H3,(H3,10,11) |
| InChIKey | FUEHVYKYTUJANM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|