C9H14N4 — CID 83875003
6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboximidamide (PubChem CID 83875003) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboximidamide.
| Compound Name | 6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 83875003 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncn2c1CCC(C)C2 |
| InChI | InChI=1S/C9H14N4/c1-6-2-3-7-8(9(10)11)12-5-13(7)4-6/h5-6H,2-4H2,1H3,(H3,10,11) |
| InChIKey | HBSJBPZZKIFAEC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|