C9H12N2O — CID 83826757
6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbaldehyde (PubChem CID 83826757) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbaldehyde.
| Compound Name | 6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 83826757 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbaldehyde |
| SMILES | CC1CCc2c(C=O)ncn2C1 |
| InChI | InChI=1S/C9H12N2O/c1-7-2-3-9-8(5-12)10-6-11(9)4-7/h5-7H,2-4H2,1H3 |
| InChIKey | FAEBACICKFUJNH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|