C9H11BrN2O — CID 84703665
3-bromo-6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbaldehyde (PubChem CID 84703665) has the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. Its IUPAC name is 3-bromo-6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbaldehyde.
| Compound Name | 3-bromo-6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 84703665 |
| Molecular Formula | C9H11BrN2O |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 3-bromo-6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbaldehyde |
| SMILES | CC1CCc2nc(C=O)c(Br)n2C1 |
| InChI | InChI=1S/C9H11BrN2O/c1-6-2-3-8-11-7(5-13)9(10)12(8)4-6/h5-6H,2-4H2,1H3 |
| InChIKey | IHFUXRSSOOABLL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|