C7H8N6S — CID 143942688
N'-amino-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide (PubChem CID 143942688) has the molecular formula C7H8N6S and a molecular weight of 208.25 g/mol. Its IUPAC name is N'-amino-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide.
| Compound Name | N'-amino-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide |
|---|---|
| PubChem CID | 143942688 |
| Molecular Formula | C7H8N6S |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | N'-amino-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboximidamide |
| SMILES | N/N=C(\N)c1ccc2n[nH]c(=S)n2c1 |
| InChI | InChI=1S/C7H8N6S/c8-6(10-9)4-1-2-5-11-12-7(14)13(5)3-4/h1-3H,9H2,(H2,8,10)(H,12,14) |
| InChIKey | KSUOWKQLWFOFMN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|