C14H13N2O+ — CID 136749704
[4-[diazenyl(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium (PubChem CID 136749704) has the molecular formula C14H13N2O+ and a molecular weight of 225.27 g/mol. Its IUPAC name is [4-[diazenyl(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium.
| Compound Name | [4-[diazenyl(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium |
|---|---|
| PubChem CID | 136749704 |
| Molecular Formula | C14H13N2O+ |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | [4-[diazenyl(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium |
| SMILES | [H]/N=N/C(=C1C=CC(=[O+]C)C=C1)c1ccccc1 |
| InChI | InChI=1S/C14H13N2O/c1-17-13-9-7-12(8-10-13)14(16-15)11-5-3-2-4-6-11/h2-10,15H,1H3/q+1/b16-15+ |
| InChIKey | AWJVVMYDQNENCP-FOCLMDBBSA-N |
| XLogP | 3.29 |
| TPSA | 47.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|