C18H19O+ — CID 143043349
methyl-[4-[(E)-2-methyl-1-phenylbut-2-enylidene]cyclohexa-2,5-dien-1-ylidene]oxidanium (PubChem CID 143043349) has the molecular formula C18H19O+ and a molecular weight of 251.35 g/mol. Its IUPAC name is methyl-[4-[(E)-2-methyl-1-phenylbut-2-enylidene]cyclohexa-2,5-dien-1-ylidene]oxidanium.
| Compound Name | methyl-[4-[(E)-2-methyl-1-phenylbut-2-enylidene]cyclohexa-2,5-dien-1-ylidene]oxidanium |
|---|---|
| PubChem CID | 143043349 |
| Molecular Formula | C18H19O+ |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | methyl-[4-[(E)-2-methyl-1-phenylbut-2-enylidene]cyclohexa-2,5-dien-1-ylidene]oxidanium |
| SMILES | C/C=C(\C)C(=C1C=CC(=[O+]C)C=C1)c1ccccc1 |
| InChI | InChI=1S/C18H19O/c1-4-14(2)18(15-8-6-5-7-9-15)16-10-12-17(19-3)13-11-16/h4-13H,1-3H3/q+1/b14-4+ |
| InChIKey | RFOVUMOBTFEMPY-LNKIKWGQSA-N |
| XLogP | 4.27 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|