C24H19Cl6OSb — CID 160793372
methyl-[4-[naphthalen-1-yl(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]oxidanium;pentachloro-λ5-stibane;chloride (PubChem CID 160793372) has the molecular formula C24H19Cl6OSb and a molecular weight of 657.89 g/mol. Its IUPAC name is methyl-[4-[naphthalen-1-yl(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]oxidanium;pentachloro-λ5-stibane;chloride.
| Compound Name | methyl-[4-[naphthalen-1-yl(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]oxidanium;pentachloro-λ5-stibane;chloride |
|---|---|
| PubChem CID | 160793372 |
| Molecular Formula | C24H19Cl6OSb |
| Molecular Weight | 657.89 g/mol |
| Exact Mass | 653.86 |
| IUPAC Name | methyl-[4-[naphthalen-1-yl(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]oxidanium;pentachloro-λ5-stibane;chloride |
| SMILES | C[O+]=C1C=CC(=C(c2ccccc2)c2cccc3ccccc23)C=C1.Cl[Sb](Cl)(Cl)(Cl)Cl.[Cl-] |
| InChI | InChI=1S/C24H19O.6ClH.Sb/c1-25-21-16-14-20(15-17-21)24(19-9-3-2-4-10-19)23-13-7-11-18-8-5-6-12-22(18)23;;;;;;;/h2-17H,1H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | ZZBJSZUSMYMMFD-UHFFFAOYSA-H |
| XLogP | 5.57 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.89 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|