C40H35O4+ — CID 101444235
[4-[[8-[bis(4-methoxyphenyl)methyl]naphthalen-1-yl]-(4-methoxyphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium (PubChem CID 101444235) has the molecular formula C40H35O4+ and a molecular weight of 579.72 g/mol. Its IUPAC name is [4-[[8-[bis(4-methoxyphenyl)methyl]naphthalen-1-yl]-(4-methoxyphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium.
| Compound Name | [4-[[8-[bis(4-methoxyphenyl)methyl]naphthalen-1-yl]-(4-methoxyphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium |
|---|---|
| PubChem CID | 101444235 |
| Molecular Formula | C40H35O4+ |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | [4-[[8-[bis(4-methoxyphenyl)methyl]naphthalen-1-yl]-(4-methoxyphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium |
| SMILES | COc1ccc(C(=C2C=CC(=[O+]C)C=C2)c2cccc3cccc(C(c4ccc(OC)cc4)c4ccc(OC)cc4)c23)cc1 |
| InChI | InChI=1S/C40H35O4/c1-41-32-19-11-28(12-20-32)38(29-13-21-33(42-2)22-14-29)36-9-5-7-27-8-6-10-37(40(27)36)39(30-15-23-34(43-3)24-16-30)31-17-25-35(44-4)26-18-31/h5-26,38H,1-4H3/q+1 |
| InChIKey | HFQMYWBBOBDXEE-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|