C24H25BF4O2 — CID 11510291
[4-[(4-methoxyphenyl)-(2,4,6-trimethylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium tetrafluoroborate (PubChem CID 11510291) has the molecular formula C24H25BF4O2 and a molecular weight of 432.27 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)-(2,4,6-trimethylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium tetrafluoroborate.
| Compound Name | [4-[(4-methoxyphenyl)-(2,4,6-trimethylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium tetrafluoroborate |
|---|---|
| PubChem CID | 11510291 |
| Molecular Formula | C24H25BF4O2 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [4-[(4-methoxyphenyl)-(2,4,6-trimethylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium tetrafluoroborate |
| SMILES | COc1ccc(C(=C2C=CC(=[O+]C)C=C2)c2c(C)cc(C)cc2C)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C24H25O2.BF4/c1-16-14-17(2)23(18(3)15-16)24(19-6-10-21(25-4)11-7-19)20-8-12-22(26-5)13-9-20;2-1(3,4)5/h6-15H,1-5H3;/q+1;-1 |
| InChIKey | YVJUVLHDYBKFPK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|