C17H18LiO2P — CID 141016363
lithium (4-methoxyphenyl)-(2,4,6-trimethylbenzoyl)phosphanide (PubChem CID 141016363) has the molecular formula C17H18LiO2P and a molecular weight of 292.24 g/mol. Its IUPAC name is lithium (4-methoxyphenyl)-(2,4,6-trimethylbenzoyl)phosphanide.
| Compound Name | lithium (4-methoxyphenyl)-(2,4,6-trimethylbenzoyl)phosphanide |
|---|---|
| PubChem CID | 141016363 |
| Molecular Formula | C17H18LiO2P |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | lithium (4-methoxyphenyl)-(2,4,6-trimethylbenzoyl)phosphanide |
| SMILES | COc1ccc([P-]C(=O)c2c(C)cc(C)cc2C)cc1.[Li+] |
| InChI | InChI=1S/C17H18O2P.Li/c1-11-9-12(2)16(13(3)10-11)17(18)20-15-7-5-14(19-4)6-8-15;/h5-10H,1-4H3;/q-1;+1 |
| InChIKey | NZLQWISVVQSTLF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|