C19H22LiO2P — CID 141016396
lithium (4-methoxy-2-methylphenyl)-(2,3,4,6-tetramethylbenzoyl)phosphanide (PubChem CID 141016396) has the molecular formula C19H22LiO2P and a molecular weight of 320.30 g/mol. Its IUPAC name is lithium (4-methoxy-2-methylphenyl)-(2,3,4,6-tetramethylbenzoyl)phosphanide.
| Compound Name | lithium (4-methoxy-2-methylphenyl)-(2,3,4,6-tetramethylbenzoyl)phosphanide |
|---|---|
| PubChem CID | 141016396 |
| Molecular Formula | C19H22LiO2P |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | lithium (4-methoxy-2-methylphenyl)-(2,3,4,6-tetramethylbenzoyl)phosphanide |
| SMILES | COc1ccc([P-]C(=O)c2c(C)cc(C)c(C)c2C)c(C)c1.[Li+] |
| InChI | InChI=1S/C19H22O2P.Li/c1-11-9-13(3)18(15(5)14(11)4)19(20)22-17-8-7-16(21-6)10-12(17)2;/h7-10H,1-6H3;/q-1;+1 |
| InChIKey | XRWAUQMMNJONBB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|