C25H34LiO3P — CID 141015930
lithium [2,4-di(butan-2-yloxy)phenyl]-(2,3,4,6-tetramethylbenzoyl)phosphanide (PubChem CID 141015930) has the molecular formula C25H34LiO3P and a molecular weight of 420.46 g/mol. Its IUPAC name is lithium [2,4-di(butan-2-yloxy)phenyl]-(2,3,4,6-tetramethylbenzoyl)phosphanide.
| Compound Name | lithium [2,4-di(butan-2-yloxy)phenyl]-(2,3,4,6-tetramethylbenzoyl)phosphanide |
|---|---|
| PubChem CID | 141015930 |
| Molecular Formula | C25H34LiO3P |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | lithium [2,4-di(butan-2-yloxy)phenyl]-(2,3,4,6-tetramethylbenzoyl)phosphanide |
| SMILES | CCC(C)Oc1ccc([P-]C(=O)c2c(C)cc(C)c(C)c2C)c(OC(C)CC)c1.[Li+] |
| InChI | InChI=1S/C25H34O3P.Li/c1-9-17(5)27-21-11-12-23(22(14-21)28-18(6)10-2)29-25(26)24-16(4)13-15(3)19(7)20(24)8;/h11-14,17-18H,9-10H2,1-8H3;/q-1;+1 |
| InChIKey | OVVRNRBEDLFDIK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|