C24H32LiO6P — CID 141015966
lithium [2,4-di(butan-2-yloxy)phenyl]-(2,4,6-trimethoxybenzoyl)phosphanide (PubChem CID 141015966) has the molecular formula C24H32LiO6P and a molecular weight of 454.43 g/mol. Its IUPAC name is lithium [2,4-di(butan-2-yloxy)phenyl]-(2,4,6-trimethoxybenzoyl)phosphanide.
| Compound Name | lithium [2,4-di(butan-2-yloxy)phenyl]-(2,4,6-trimethoxybenzoyl)phosphanide |
|---|---|
| PubChem CID | 141015966 |
| Molecular Formula | C24H32LiO6P |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | lithium [2,4-di(butan-2-yloxy)phenyl]-(2,4,6-trimethoxybenzoyl)phosphanide |
| SMILES | CCC(C)Oc1ccc([P-]C(=O)c2c(OC)cc(OC)cc2OC)c(OC(C)CC)c1.[Li+] |
| InChI | InChI=1S/C24H32O6P.Li/c1-8-15(3)29-17-10-11-22(19(12-17)30-16(4)9-2)31-24(25)23-20(27-6)13-18(26-5)14-21(23)28-7;/h10-16H,8-9H2,1-7H3;/q-1;+1 |
| InChIKey | QIKKSQQGQQJYME-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|