C14H22LiO2P — CID 141016038
lithium [2,4-di(butan-2-yloxy)phenyl]phosphanide (PubChem CID 141016038) has the molecular formula C14H22LiO2P and a molecular weight of 260.24 g/mol. Its IUPAC name is lithium [2,4-di(butan-2-yloxy)phenyl]phosphanide.
| Compound Name | lithium [2,4-di(butan-2-yloxy)phenyl]phosphanide |
|---|---|
| PubChem CID | 141016038 |
| Molecular Formula | C14H22LiO2P |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | lithium [2,4-di(butan-2-yloxy)phenyl]phosphanide |
| SMILES | CCC(C)Oc1ccc([PH-])c(OC(C)CC)c1.[Li+] |
| InChI | InChI=1S/C14H22O2P.Li/c1-5-10(3)15-12-7-8-14(17)13(9-12)16-11(4)6-2;/h7-11,17H,5-6H2,1-4H3;/q-1;+1 |
| InChIKey | KWAGRRSSGALEAG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|