C21H37NO2 — CID 54805292
N-[[2,4-di(butan-2-yloxy)phenyl]methyl]hexan-1-amine (PubChem CID 54805292) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is N-[[2,4-di(butan-2-yloxy)phenyl]methyl]hexan-1-amine.
| Compound Name | N-[[2,4-di(butan-2-yloxy)phenyl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 54805292 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | N-[[2,4-di(butan-2-yloxy)phenyl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1ccc(OC(C)CC)cc1OC(C)CC |
| InChI | InChI=1S/C21H37NO2/c1-6-9-10-11-14-22-16-19-12-13-20(23-17(4)7-2)15-21(19)24-18(5)8-3/h12-13,15,17-18,22H,6-11,14,16H2,1-5H3 |
| InChIKey | ZCZAZFHYTZDLHU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|