C19H23LiO4P — CID 70014116
CID 70014116 (PubChem CID 70014116) has the molecular formula C19H23LiO4P and a molecular weight of 353.30 g/mol.
| Compound Name | CID 70014116 |
|---|---|
| PubChem CID | 70014116 |
| Molecular Formula | C19H23LiO4P |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | — |
| SMILES | CCC(C)Oc1ccc(PC(=O)c2c(OC)cccc2OC)cc1.[Li] |
| InChI | InChI=1S/C19H23O4P.Li/c1-5-13(2)23-14-9-11-15(12-10-14)24-19(20)18-16(21-3)7-6-8-17(18)22-4;/h6-13,24H,5H2,1-4H3; |
| InChIKey | MOGIAHOTRUNEPU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|