C23H31LiO3P — CID 70016722
CID 70016722 (PubChem CID 70016722) has the molecular formula C23H31LiO3P and a molecular weight of 393.41 g/mol.
| Compound Name | CID 70016722 |
|---|---|
| PubChem CID | 70016722 |
| Molecular Formula | C23H31LiO3P |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | — |
| SMILES | CCC(C)Oc1ccc(PC(=O)c2c(C)cccc2C)c(OC(C)CC)c1.[Li] |
| InChI | InChI=1S/C23H31O3P.Li/c1-7-17(5)25-19-12-13-21(20(14-19)26-18(6)8-2)27-23(24)22-15(3)10-9-11-16(22)4;/h9-14,17-18,27H,7-8H2,1-6H3; |
| InChIKey | MANCQHOPJPSXFT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|