C20H24ClLiO3P+ — CID 18514643
lithium (2-chloro-6-methylphenyl)-[2,4-di(propan-2-yloxy)phenyl]phosphanylmethanone (PubChem CID 18514643) has the molecular formula C20H24ClLiO3P+ and a molecular weight of 385.78 g/mol. Its IUPAC name is lithium (2-chloro-6-methylphenyl)-[2,4-di(propan-2-yloxy)phenyl]phosphanylmethanone.
| Compound Name | lithium (2-chloro-6-methylphenyl)-[2,4-di(propan-2-yloxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18514643 |
| Molecular Formula | C20H24ClLiO3P+ |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | lithium (2-chloro-6-methylphenyl)-[2,4-di(propan-2-yloxy)phenyl]phosphanylmethanone |
| SMILES | Cc1cccc(Cl)c1C(=O)Pc1ccc(OC(C)C)cc1OC(C)C.[Li+] |
| InChI | InChI=1S/C20H24ClO3P.Li/c1-12(2)23-15-9-10-18(17(11-15)24-13(3)4)25-20(22)19-14(5)7-6-8-16(19)21;/h6-13,25H,1-5H3;/q;+1 |
| InChIKey | TXYNOOGNJHDUAH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|