About lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride
lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride (PubChem CID 173244894) has the molecular formula C15H15ClLiOP
and a molecular weight of 284.65 g/mol. Its IUPAC name is lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride.
Molecular Properties
| Compound Name | lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride |
| PubChem CID | 173244894 |
| Molecular Formula | C15H15ClLiOP |
| Molecular Weight | 284.65 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride |
| SMILES | Cc1ccccc1PC(=O)c1c(C)cccc1Cl.[H-].[Li+] |
| InChI | InChI=1S/C15H14ClOP.Li.H/c1-10-6-3-4-9-13(10)18-15(17)14-11(2)7-5-8-12(14)16;;/h3-9,18H,1-2H3;;/q;+1;-1 |
| InChIKey | ILTCMWNIRJZVPU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.65 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride?
The IUPAC name of lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride (CID 173244894) is lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride.
What is the SMILES notation for lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride?
The canonical SMILES for lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride is Cc1ccccc1PC(=O)c1c(C)cccc1Cl.[H-].[Li+].
What is the InChIKey of lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride?
The InChIKey is ILTCMWNIRJZVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClOP.Li.H/c1-10-6-3-4-9-13(10)18-15(17)14-11(2)7-5-8-12(14)16;;/h3-9,18H,1-2H3;;/q;+1;-1.
What are the key properties of lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride?
lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride has a molecular weight of 284.65 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;(2-chloro-6-methylphenyl)-(2-methylphenyl)phosphanylmethanone;hydride is sourced from PubChem (CID 173244894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).