C16H11F6OP — CID 18514892
[2,6-bis(trifluoromethyl)phenyl]-(2-methylphenyl)phosphanylmethanone (PubChem CID 18514892) has the molecular formula C16H11F6OP and a molecular weight of 364.23 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]-(2-methylphenyl)phosphanylmethanone.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]-(2-methylphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514892 |
| Molecular Formula | C16H11F6OP |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]-(2-methylphenyl)phosphanylmethanone |
| SMILES | Cc1ccccc1PC(=O)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C16H11F6OP/c1-9-5-2-3-8-12(9)24-14(23)13-10(15(17,18)19)6-4-7-11(13)16(20,21)22/h2-8,24H,1H3 |
| InChIKey | GLSXORKBAQCVSB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|