C19H18F6LiO3P — CID 173244560
lithium;[4-ethoxy-2,6-bis(trifluoromethyl)phenyl]-(2-ethoxyphenyl)phosphanylmethanone;hydride (PubChem CID 173244560) has the molecular formula C19H18F6LiO3P and a molecular weight of 446.25 g/mol. Its IUPAC name is lithium;[4-ethoxy-2,6-bis(trifluoromethyl)phenyl]-(2-ethoxyphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;[4-ethoxy-2,6-bis(trifluoromethyl)phenyl]-(2-ethoxyphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244560 |
| Molecular Formula | C19H18F6LiO3P |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | lithium;[4-ethoxy-2,6-bis(trifluoromethyl)phenyl]-(2-ethoxyphenyl)phosphanylmethanone;hydride |
| SMILES | CCOc1cc(C(F)(F)F)c(C(=O)Pc2ccccc2OCC)c(C(F)(F)F)c1.[H-].[Li+] |
| InChI | InChI=1S/C19H17F6O3P.Li.H/c1-3-27-11-9-12(18(20,21)22)16(13(10-11)19(23,24)25)17(26)29-15-8-6-5-7-14(15)28-4-2;;/h5-10,29H,3-4H2,1-2H3;;/q;+1;-1 |
| InChIKey | GIURPBUVTNNUGS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|