C16H15Cl2O3P — CID 18514642
(2,6-dichloro-4-methoxyphenyl)-(2-ethoxyphenyl)phosphanylmethanone (PubChem CID 18514642) has the molecular formula C16H15Cl2O3P and a molecular weight of 357.17 g/mol. Its IUPAC name is (2,6-dichloro-4-methoxyphenyl)-(2-ethoxyphenyl)phosphanylmethanone.
| Compound Name | (2,6-dichloro-4-methoxyphenyl)-(2-ethoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514642 |
| Molecular Formula | C16H15Cl2O3P |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | (2,6-dichloro-4-methoxyphenyl)-(2-ethoxyphenyl)phosphanylmethanone |
| SMILES | CCOc1ccccc1PC(=O)c1c(Cl)cc(OC)cc1Cl |
| InChI | InChI=1S/C16H15Cl2O3P/c1-3-21-13-6-4-5-7-14(13)22-16(19)15-11(17)8-10(20-2)9-12(15)18/h4-9,22H,3H2,1-2H3 |
| InChIKey | GIXYIKVSRRJWLU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|