C20H25ClLiO5P — CID 173245877
lithium;(2-chloro-6-methoxyphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone;hydride (PubChem CID 173245877) has the molecular formula C20H25ClLiO5P and a molecular weight of 418.78 g/mol. Its IUPAC name is lithium;(2-chloro-6-methoxyphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;(2-chloro-6-methoxyphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245877 |
| Molecular Formula | C20H25ClLiO5P |
| Molecular Weight | 418.78 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | lithium;(2-chloro-6-methoxyphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone;hydride |
| SMILES | CCOc1cc(OCC)c(PC(=O)c2c(Cl)cccc2OC)c(OCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C20H24ClO5P.Li.H/c1-5-24-13-11-16(25-6-2)19(17(12-13)26-7-3)27-20(22)18-14(21)9-8-10-15(18)23-4;;/h8-12,27H,5-7H2,1-4H3;;/q;+1;-1 |
| InChIKey | FHNFZOPFLHKEEO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|