C20H24ClO4P — CID 18514959
(2-chloro-6-methylphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone (PubChem CID 18514959) has the molecular formula C20H24ClO4P and a molecular weight of 394.84 g/mol. Its IUPAC name is (2-chloro-6-methylphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone.
| Compound Name | (2-chloro-6-methylphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514959 |
| Molecular Formula | C20H24ClO4P |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (2-chloro-6-methylphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone |
| SMILES | CCOc1cc(OCC)c(PC(=O)c2c(C)cccc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C20H24ClO4P/c1-5-23-14-11-16(24-6-2)19(17(12-14)25-7-3)26-20(22)18-13(4)9-8-10-15(18)21/h8-12,26H,5-7H2,1-4H3 |
| InChIKey | SPDGBLZTIUPZII-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|