C23H31LiO4P+ — CID 18514443
lithium (2,3,4,6-tetramethylphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone (PubChem CID 18514443) has the molecular formula C23H31LiO4P+ and a molecular weight of 409.41 g/mol. Its IUPAC name is lithium (2,3,4,6-tetramethylphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone.
| Compound Name | lithium (2,3,4,6-tetramethylphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514443 |
| Molecular Formula | C23H31LiO4P+ |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | lithium (2,3,4,6-tetramethylphenyl)-(2,4,6-triethoxyphenyl)phosphanylmethanone |
| SMILES | CCOc1cc(OCC)c(PC(=O)c2c(C)cc(C)c(C)c2C)c(OCC)c1.[Li+] |
| InChI | InChI=1S/C23H31O4P.Li/c1-8-25-18-12-19(26-9-2)22(20(13-18)27-10-3)28-23(24)21-15(5)11-14(4)16(6)17(21)7;/h11-13,28H,8-10H2,1-7H3;/q;+1 |
| InChIKey | SUROVVZYDNWJKA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|